C17H16BrFN4O3 — CID 24640870
1-[2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea (PubChem CID 24640870) has the molecular formula C17H16BrFN4O3 and a molecular weight of 423.24 g/mol. Its IUPAC name is 1-[2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-[2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 24640870 |
| Molecular Formula | C17H16BrFN4O3 |
| Molecular Weight | 423.24 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 1-[2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea |
| SMILES | O=C(CNC(=O)NCc1ccc(F)cc1)NNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H16BrFN4O3/c18-13-5-3-12(4-6-13)16(25)23-22-15(24)10-21-17(26)20-9-11-1-7-14(19)8-2-11/h1-8H,9-10H2,(H,22,24)(H,23,25)(H2,20,21,26) |
| InChIKey | BCEUMONRESAWBI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|