C18H14F2N2OS — CID 25397079
3,5-difluoro-N-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]benzamide (PubChem CID 25397079) has the molecular formula C18H14F2N2OS and a molecular weight of 344.39 g/mol. Its IUPAC name is 3,5-difluoro-N-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]benzamide.
| Compound Name | 3,5-difluoro-N-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 25397079 |
| Molecular Formula | C18H14F2N2OS |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 3,5-difluoro-N-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]benzamide |
| SMILES | Cc1nc(-c2ccc(CNC(=O)c3cc(F)cc(F)c3)cc2)cs1 |
| InChI | InChI=1S/C18H14F2N2OS/c1-11-22-17(10-24-11)13-4-2-12(3-5-13)9-21-18(23)14-6-15(19)8-16(20)7-14/h2-8,10H,9H2,1H3,(H,21,23) |
| InChIKey | SZSAGIPMRXDMPN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |