C21H29N2O2+ — CID 8947985
diethyl-[[4-[[[4-(methoxymethyl)benzoyl]amino]methyl]phenyl]methyl]azanium (PubChem CID 8947985) has the molecular formula C21H29N2O2+ and a molecular weight of 341.48 g/mol. Its IUPAC name is diethyl-[[4-[[[4-(methoxymethyl)benzoyl]amino]methyl]phenyl]methyl]azanium.
| Compound Name | diethyl-[[4-[[[4-(methoxymethyl)benzoyl]amino]methyl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 8947985 |
| Molecular Formula | C21H29N2O2+ |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | diethyl-[[4-[[[4-(methoxymethyl)benzoyl]amino]methyl]phenyl]methyl]azanium |
| SMILES | CC[NH+](CC)Cc1ccc(CNC(=O)c2ccc(COC)cc2)cc1 |
| InChI | InChI=1S/C21H28N2O2/c1-4-23(5-2)15-18-8-6-17(7-9-18)14-22-21(24)20-12-10-19(11-13-20)16-25-3/h6-13H,4-5,14-16H2,1-3H3,(H,22,24)/p+1 |
| InChIKey | BIIZGORDPLOSJQ-UHFFFAOYSA-O |
| XLogP | 2.19 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |