C26H30N5O+ — CID 8948581
[4-[[[4-(benzotriazol-1-ylmethyl)benzoyl]amino]methyl]phenyl]methyl-diethylazanium (PubChem CID 8948581) has the molecular formula C26H30N5O+ and a molecular weight of 428.56 g/mol. Its IUPAC name is [4-[[[4-(benzotriazol-1-ylmethyl)benzoyl]amino]methyl]phenyl]methyl-diethylazanium.
| Compound Name | [4-[[[4-(benzotriazol-1-ylmethyl)benzoyl]amino]methyl]phenyl]methyl-diethylazanium |
|---|---|
| PubChem CID | 8948581 |
| Molecular Formula | C26H30N5O+ |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | [4-[[[4-(benzotriazol-1-ylmethyl)benzoyl]amino]methyl]phenyl]methyl-diethylazanium |
| SMILES | CC[NH+](CC)Cc1ccc(CNC(=O)c2ccc(Cn3nnc4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C26H29N5O/c1-3-30(4-2)18-21-11-9-20(10-12-21)17-27-26(32)23-15-13-22(14-16-23)19-31-25-8-6-5-7-24(25)28-29-31/h5-16H,3-4,17-19H2,1-2H3,(H,27,32)/p+1 |
| InChIKey | LWKJLTRRGJQBQU-UHFFFAOYSA-O |
| XLogP | 2.83 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |