C17H19N5O3S — CID 36907384
4-(benzotriazol-1-ylmethyl)-N-[2-(methanesulfonamido)ethyl]benzamide (PubChem CID 36907384) has the molecular formula C17H19N5O3S and a molecular weight of 373.44 g/mol. Its IUPAC name is 4-(benzotriazol-1-ylmethyl)-N-[2-(methanesulfonamido)ethyl]benzamide.
| Compound Name | 4-(benzotriazol-1-ylmethyl)-N-[2-(methanesulfonamido)ethyl]benzamide |
|---|---|
| PubChem CID | 36907384 |
| Molecular Formula | C17H19N5O3S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 4-(benzotriazol-1-ylmethyl)-N-[2-(methanesulfonamido)ethyl]benzamide |
| SMILES | CS(=O)(=O)NCCNC(=O)c1ccc(Cn2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C17H19N5O3S/c1-26(24,25)19-11-10-18-17(23)14-8-6-13(7-9-14)12-22-16-5-3-2-4-15(16)20-21-22/h2-9,19H,10-12H2,1H3,(H,18,23) |
| InChIKey | KKXPFZZDPGGCTJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|