C18H18N4O4 — CID 9085092
methyl (2R)-2-[[4-(benzotriazol-1-ylmethyl)benzoyl]amino]-3-hydroxypropanoate (PubChem CID 9085092) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is methyl (2R)-2-[[4-(benzotriazol-1-ylmethyl)benzoyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl (2R)-2-[[4-(benzotriazol-1-ylmethyl)benzoyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 9085092 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | methyl (2R)-2-[[4-(benzotriazol-1-ylmethyl)benzoyl]amino]-3-hydroxypropanoate |
| SMILES | COC(=O)[C@@H](CO)NC(=O)c1ccc(Cn2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C18H18N4O4/c1-26-18(25)15(11-23)19-17(24)13-8-6-12(7-9-13)10-22-16-5-3-2-4-14(16)20-21-22/h2-9,15,23H,10-11H2,1H3,(H,19,24)/t15-/m1/s1 |
| InChIKey | DLQCSJZZDQDFEI-OAHLLOKOSA-N |
| XLogP | 0.74 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |