C12H19N3O — CID 62694012
2-(methylamino)-N-(2-methylbutyl)pyridine-4-carboxamide (PubChem CID 62694012) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-(methylamino)-N-(2-methylbutyl)pyridine-4-carboxamide.
| Compound Name | 2-(methylamino)-N-(2-methylbutyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62694012 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 2-(methylamino)-N-(2-methylbutyl)pyridine-4-carboxamide |
| SMILES | CCC(C)CNC(=O)c1ccnc(NC)c1 |
| InChI | InChI=1S/C12H19N3O/c1-4-9(2)8-15-12(16)10-5-6-14-11(7-10)13-3/h5-7,9H,4,8H2,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | YJDGMOHQHXKEBO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |