C7H9N5O — CID 106231075
N-pent-1-yn-3-yl-2H-tetrazole-5-carboxamide (PubChem CID 106231075) has the molecular formula C7H9N5O and a molecular weight of 179.18 g/mol. Its IUPAC name is N-pent-1-yn-3-yl-2H-tetrazole-5-carboxamide.
| Compound Name | N-pent-1-yn-3-yl-2H-tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 106231075 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | N-pent-1-yn-3-yl-2H-tetrazole-5-carboxamide |
| SMILES | C#CC(CC)NC(=O)c1nn[nH]n1 |
| InChI | InChI=1S/C7H9N5O/c1-3-5(4-2)8-7(13)6-9-11-12-10-6/h1,5H,4H2,2H3,(H,8,13)(H,9,10,11,12) |
| InChIKey | AGBZFWJCUDNXGW-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|