C5H9N5O2 — CID 107858481
N-[(2S)-1-hydroxypropan-2-yl]-2H-tetrazole-5-carboxamide (PubChem CID 107858481) has the molecular formula C5H9N5O2 and a molecular weight of 171.16 g/mol. Its IUPAC name is N-[(2S)-1-hydroxypropan-2-yl]-2H-tetrazole-5-carboxamide.
| Compound Name | N-[(2S)-1-hydroxypropan-2-yl]-2H-tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 107858481 |
| Molecular Formula | C5H9N5O2 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | N-[(2S)-1-hydroxypropan-2-yl]-2H-tetrazole-5-carboxamide |
| SMILES | C[C@@H](CO)NC(=O)c1nn[nH]n1 |
| InChI | InChI=1S/C5H9N5O2/c1-3(2-11)6-5(12)4-7-9-10-8-4/h3,11H,2H2,1H3,(H,6,12)(H,7,8,9,10)/t3-/m0/s1 |
| InChIKey | SKEXNBDBALUEFK-VKHMYHEASA-N |
| XLogP | -1.69 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |