C7H13N5O2S — CID 106162645
N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2H-tetrazole-5-carboxamide (PubChem CID 106162645) has the molecular formula C7H13N5O2S and a molecular weight of 231.28 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2H-tetrazole-5-carboxamide.
| Compound Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2H-tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 106162645 |
| Molecular Formula | C7H13N5O2S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2H-tetrazole-5-carboxamide |
| SMILES | CSC(CO)C(C)NC(=O)c1nn[nH]n1 |
| InChI | InChI=1S/C7H13N5O2S/c1-4(5(3-13)15-2)8-7(14)6-9-11-12-10-6/h4-5,13H,3H2,1-2H3,(H,8,14)(H,9,10,11,12) |
| InChIKey | GGEMIZKDPRNGLJ-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |