C8H6AlF5S — CID 140617822
dimethyl-(2,3,4,5,6-pentafluorophenyl)sulfanylalumane (PubChem CID 140617822) has the molecular formula C8H6AlF5S and a molecular weight of 256.17 g/mol. Its IUPAC name is dimethyl-(2,3,4,5,6-pentafluorophenyl)sulfanylalumane.
| Compound Name | dimethyl-(2,3,4,5,6-pentafluorophenyl)sulfanylalumane |
|---|---|
| PubChem CID | 140617822 |
| Molecular Formula | C8H6AlF5S |
| Molecular Weight | 256.17 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | dimethyl-(2,3,4,5,6-pentafluorophenyl)sulfanylalumane |
| SMILES | C[Al](C)Sc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6HF5S.2CH3.Al/c7-1-2(8)4(10)6(12)5(11)3(1)9;;;/h12H;2*1H3;/q;;;+1/p-1 |
| InChIKey | VVVJDKRYITZRJQ-UHFFFAOYSA-M |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.17 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|