C13H5AlF10N2 — CID 20872998
2,3,4,5,6-pentafluoro-N-[methyl-(2,3,4,5,6-pentafluoroanilino)alumanyl]aniline (PubChem CID 20872998) has the molecular formula C13H5AlF10N2 and a molecular weight of 406.16 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[methyl-(2,3,4,5,6-pentafluoroanilino)alumanyl]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[methyl-(2,3,4,5,6-pentafluoroanilino)alumanyl]aniline |
|---|---|
| PubChem CID | 20872998 |
| Molecular Formula | C13H5AlF10N2 |
| Molecular Weight | 406.16 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[methyl-(2,3,4,5,6-pentafluoroanilino)alumanyl]aniline |
| SMILES | C[Al](Nc1c(F)c(F)c(F)c(F)c1F)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/2C6HF5N.CH3.Al/c2*7-1-2(8)4(10)6(12)5(11)3(1)9;;/h2*12H;1H3;/q2*-1;;+2 |
| InChIKey | XZQYHNLTCGIASH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.16 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|