C9H9F5N3+ — CID 3383603
dimethyl-[[2-(2,3,4,5,6-pentafluorophenyl)hydrazinyl]methylidene]azanium (PubChem CID 3383603) has the molecular formula C9H9F5N3+ and a molecular weight of 254.18 g/mol. Its IUPAC name is dimethyl-[[2-(2,3,4,5,6-pentafluorophenyl)hydrazinyl]methylidene]azanium.
| Compound Name | dimethyl-[[2-(2,3,4,5,6-pentafluorophenyl)hydrazinyl]methylidene]azanium |
|---|---|
| PubChem CID | 3383603 |
| Molecular Formula | C9H9F5N3+ |
| Molecular Weight | 254.18 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | dimethyl-[[2-(2,3,4,5,6-pentafluorophenyl)hydrazinyl]methylidene]azanium |
| SMILES | C[N+](C)=CNNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H8F5N3/c1-17(2)3-15-16-9-7(13)5(11)4(10)6(12)8(9)14/h3,16H,1-2H3/p+1 |
| InChIKey | ZSPJSOGTSHLNFC-UHFFFAOYSA-O |
| XLogP | 1.60 |
| TPSA | 27.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|