C10H7ClF5N — CID 114188786
N-(3-chloro-2-methylprop-2-enyl)-2,3,4,5,6-pentafluoroaniline (PubChem CID 114188786) has the molecular formula C10H7ClF5N and a molecular weight of 271.62 g/mol. Its IUPAC name is N-(3-chloro-2-methylprop-2-enyl)-2,3,4,5,6-pentafluoroaniline.
| Compound Name | N-(3-chloro-2-methylprop-2-enyl)-2,3,4,5,6-pentafluoroaniline |
|---|---|
| PubChem CID | 114188786 |
| Molecular Formula | C10H7ClF5N |
| Molecular Weight | 271.62 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | N-(3-chloro-2-methylprop-2-enyl)-2,3,4,5,6-pentafluoroaniline |
| SMILES | CC(=CCl)CNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H7ClF5N/c1-4(2-11)3-17-10-8(15)6(13)5(12)7(14)9(10)16/h2,17H,3H2,1H3 |
| InChIKey | DBWSIWBSUVGTRB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.62 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|