C12H12F7N — CID 22349022
N-(1,2-difluorohexyl)-2,3,4,5,6-pentafluoroaniline (PubChem CID 22349022) has the molecular formula C12H12F7N and a molecular weight of 303.22 g/mol. Its IUPAC name is N-(1,2-difluorohexyl)-2,3,4,5,6-pentafluoroaniline.
| Compound Name | N-(1,2-difluorohexyl)-2,3,4,5,6-pentafluoroaniline |
|---|---|
| PubChem CID | 22349022 |
| Molecular Formula | C12H12F7N |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | N-(1,2-difluorohexyl)-2,3,4,5,6-pentafluoroaniline |
| SMILES | CCCCC(F)C(F)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H12F7N/c1-2-3-4-5(13)12(19)20-11-9(17)7(15)6(14)8(16)10(11)18/h5,12,20H,2-4H2,1H3 |
| InChIKey | GZIOTSPEVHTYSK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|