C13H14F5N3O2 — CID 17424165
N-[3-methyl-1-oxo-1-[2-(2,3,4,5,6-pentafluorophenyl)hydrazinyl]butan-2-yl]acetamide (PubChem CID 17424165) has the molecular formula C13H14F5N3O2 and a molecular weight of 339.26 g/mol. Its IUPAC name is N-[3-methyl-1-oxo-1-[2-(2,3,4,5,6-pentafluorophenyl)hydrazinyl]butan-2-yl]acetamide.
| Compound Name | N-[3-methyl-1-oxo-1-[2-(2,3,4,5,6-pentafluorophenyl)hydrazinyl]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 17424165 |
| Molecular Formula | C13H14F5N3O2 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-[3-methyl-1-oxo-1-[2-(2,3,4,5,6-pentafluorophenyl)hydrazinyl]butan-2-yl]acetamide |
| SMILES | CC(=O)NC(C(=O)NNc1c(F)c(F)c(F)c(F)c1F)C(C)C |
| InChI | InChI=1S/C13H14F5N3O2/c1-4(2)11(19-5(3)22)13(23)21-20-12-9(17)7(15)6(14)8(16)10(12)18/h4,11,20H,1-3H3,(H,19,22)(H,21,23) |
| InChIKey | FOWBJDQTJAUNDK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|