C17H26N4O2S — CID 9157611
N-[(2S)-3-methyl-1-oxo-1-[2-[(4-propan-2-ylphenyl)carbamothioyl]hydrazinyl]butan-2-yl]acetamide (PubChem CID 9157611) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is N-[(2S)-3-methyl-1-oxo-1-[2-[(4-propan-2-ylphenyl)carbamothioyl]hydrazinyl]butan-2-yl]acetamide.
| Compound Name | N-[(2S)-3-methyl-1-oxo-1-[2-[(4-propan-2-ylphenyl)carbamothioyl]hydrazinyl]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 9157611 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | N-[(2S)-3-methyl-1-oxo-1-[2-[(4-propan-2-ylphenyl)carbamothioyl]hydrazinyl]butan-2-yl]acetamide |
| SMILES | CC(=O)N[C@H](C(=O)NNC(=S)Nc1ccc(C(C)C)cc1)C(C)C |
| InChI | InChI=1S/C17H26N4O2S/c1-10(2)13-6-8-14(9-7-13)19-17(24)21-20-16(23)15(11(3)4)18-12(5)22/h6-11,15H,1-5H3,(H,18,22)(H,20,23)(H2,19,21,24)/t15-/m0/s1 |
| InChIKey | WBLLQHCHKGDGJZ-HNNXBMFYSA-N |
| XLogP | 2.29 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|