C13H19N3O2S — CID 7988099
ethyl N-[(4-propan-2-ylphenyl)carbamothioylamino]carbamate (PubChem CID 7988099) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is ethyl N-[(4-propan-2-ylphenyl)carbamothioylamino]carbamate.
| Compound Name | ethyl N-[(4-propan-2-ylphenyl)carbamothioylamino]carbamate |
|---|---|
| PubChem CID | 7988099 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | ethyl N-[(4-propan-2-ylphenyl)carbamothioylamino]carbamate |
| SMILES | CCOC(=O)NNC(=S)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C13H19N3O2S/c1-4-18-13(17)16-15-12(19)14-11-7-5-10(6-8-11)9(2)3/h5-9H,4H2,1-3H3,(H,16,17)(H2,14,15,19) |
| InChIKey | YCMMZVDRTRKANX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|