C15H20F3N3O2S — CID 8969156
1-(4-propan-2-ylphenyl)-3-[[(3R)-4,4,4-trifluoro-3-hydroxy-3-methylbutanoyl]amino]thiourea (PubChem CID 8969156) has the molecular formula C15H20F3N3O2S and a molecular weight of 363.41 g/mol. Its IUPAC name is 1-(4-propan-2-ylphenyl)-3-[[(3R)-4,4,4-trifluoro-3-hydroxy-3-methylbutanoyl]amino]thiourea.
| Compound Name | 1-(4-propan-2-ylphenyl)-3-[[(3R)-4,4,4-trifluoro-3-hydroxy-3-methylbutanoyl]amino]thiourea |
|---|---|
| PubChem CID | 8969156 |
| Molecular Formula | C15H20F3N3O2S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-(4-propan-2-ylphenyl)-3-[[(3R)-4,4,4-trifluoro-3-hydroxy-3-methylbutanoyl]amino]thiourea |
| SMILES | CC(C)c1ccc(NC(=S)NNC(=O)C[C@@](C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H20F3N3O2S/c1-9(2)10-4-6-11(7-5-10)19-13(24)21-20-12(22)8-14(3,23)15(16,17)18/h4-7,9,23H,8H2,1-3H3,(H,20,22)(H2,19,21,24)/t14-/m1/s1 |
| InChIKey | HXVOXDHQINCZHH-CQSZACIVSA-N |
| XLogP | 2.83 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|