C18H18F3N3O2S — CID 9158023
1-(4-propan-2-ylphenyl)-3-[[4-(trifluoromethoxy)benzoyl]amino]thiourea (PubChem CID 9158023) has the molecular formula C18H18F3N3O2S and a molecular weight of 397.42 g/mol. Its IUPAC name is 1-(4-propan-2-ylphenyl)-3-[[4-(trifluoromethoxy)benzoyl]amino]thiourea.
| Compound Name | 1-(4-propan-2-ylphenyl)-3-[[4-(trifluoromethoxy)benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 9158023 |
| Molecular Formula | C18H18F3N3O2S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 1-(4-propan-2-ylphenyl)-3-[[4-(trifluoromethoxy)benzoyl]amino]thiourea |
| SMILES | CC(C)c1ccc(NC(=S)NNC(=O)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H18F3N3O2S/c1-11(2)12-3-7-14(8-4-12)22-17(27)24-23-16(25)13-5-9-15(10-6-13)26-18(19,20)21/h3-11H,1-2H3,(H,23,25)(H2,22,24,27) |
| InChIKey | BFLIIVZXEIEZSF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|