C21H28N4O3S — CID 9271905
ethyl 2,5-dimethyl-1-[2-oxo-2-[2-[(4-propan-2-ylphenyl)carbamothioyl]hydrazinyl]ethyl]pyrrole-3-carboxylate (PubChem CID 9271905) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is ethyl 2,5-dimethyl-1-[2-oxo-2-[2-[(4-propan-2-ylphenyl)carbamothioyl]hydrazinyl]ethyl]pyrrole-3-carboxylate.
| Compound Name | ethyl 2,5-dimethyl-1-[2-oxo-2-[2-[(4-propan-2-ylphenyl)carbamothioyl]hydrazinyl]ethyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 9271905 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | ethyl 2,5-dimethyl-1-[2-oxo-2-[2-[(4-propan-2-ylphenyl)carbamothioyl]hydrazinyl]ethyl]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)n(CC(=O)NNC(=S)Nc2ccc(C(C)C)cc2)c1C |
| InChI | InChI=1S/C21H28N4O3S/c1-6-28-20(27)18-11-14(4)25(15(18)5)12-19(26)23-24-21(29)22-17-9-7-16(8-10-17)13(2)3/h7-11,13H,6,12H2,1-5H3,(H,23,26)(H2,22,24,29) |
| InChIKey | XPQRFBRQJOOINP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|