C22H29N3O4 — CID 9327528
ethyl 1-[2-[2-(4-tert-butylbenzoyl)hydrazinyl]-2-oxoethyl]-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 9327528) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is ethyl 1-[2-[2-(4-tert-butylbenzoyl)hydrazinyl]-2-oxoethyl]-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | ethyl 1-[2-[2-(4-tert-butylbenzoyl)hydrazinyl]-2-oxoethyl]-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 9327528 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | ethyl 1-[2-[2-(4-tert-butylbenzoyl)hydrazinyl]-2-oxoethyl]-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)n(CC(=O)NNC(=O)c2ccc(C(C)(C)C)cc2)c1C |
| InChI | InChI=1S/C22H29N3O4/c1-7-29-21(28)18-12-14(2)25(15(18)3)13-19(26)23-24-20(27)16-8-10-17(11-9-16)22(4,5)6/h8-12H,7,13H2,1-6H3,(H,23,26)(H,24,27) |
| InChIKey | QCMYOSWIADDJFZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|