C8H3F5N2 — CID 115564372
2-(2,3,4,5,6-pentafluoroanilino)acetonitrile (PubChem CID 115564372) has the molecular formula C8H3F5N2 and a molecular weight of 222.12 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluoroanilino)acetonitrile.
| Compound Name | 2-(2,3,4,5,6-pentafluoroanilino)acetonitrile |
|---|---|
| PubChem CID | 115564372 |
| Molecular Formula | C8H3F5N2 |
| Molecular Weight | 222.12 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluoroanilino)acetonitrile |
| SMILES | N#CCNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H3F5N2/c9-3-4(10)6(12)8(15-2-1-14)7(13)5(3)11/h15H,2H2 |
| InChIKey | XIXSOWNSPSZLOT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.12 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|