C12H14F4 — CID 150741990
1,2,3,4-tetrafluoro-5,6-di(propan-2-yl)benzene (PubChem CID 150741990) has the molecular formula C12H14F4 and a molecular weight of 234.24 g/mol. Its IUPAC name is 1,2,3,4-tetrafluoro-5,6-di(propan-2-yl)benzene.
| Compound Name | 1,2,3,4-tetrafluoro-5,6-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 150741990 |
| Molecular Formula | C12H14F4 |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1,2,3,4-tetrafluoro-5,6-di(propan-2-yl)benzene |
| SMILES | CC(C)c1c(F)c(F)c(F)c(F)c1C(C)C |
| InChI | InChI=1S/C12H14F4/c1-5(2)7-8(6(3)4)10(14)12(16)11(15)9(7)13/h5-6H,1-4H3 |
| InChIKey | JUAZCPPGUIOYLN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|