C11H12F4 — CID 122480972
1-ethyl-2,3,5,6-tetrafluoro-4-propan-2-ylbenzene (PubChem CID 122480972) has the molecular formula C11H12F4 and a molecular weight of 220.21 g/mol. Its IUPAC name is 1-ethyl-2,3,5,6-tetrafluoro-4-propan-2-ylbenzene.
| Compound Name | 1-ethyl-2,3,5,6-tetrafluoro-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 122480972 |
| Molecular Formula | C11H12F4 |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 1-ethyl-2,3,5,6-tetrafluoro-4-propan-2-ylbenzene |
| SMILES | CCc1c(F)c(F)c(C(C)C)c(F)c1F |
| InChI | InChI=1S/C11H12F4/c1-4-6-8(12)10(14)7(5(2)3)11(15)9(6)13/h5H,4H2,1-3H3 |
| InChIKey | AICDCJPVDHKPOZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|