C24H14F12S2 — CID 135273031
1,2,4,5-tetrafluoro-3,6-bis[(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)sulfanyl]benzene (PubChem CID 135273031) has the molecular formula C24H14F12S2 and a molecular weight of 594.49 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3,6-bis[(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)sulfanyl]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3,6-bis[(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)sulfanyl]benzene |
|---|---|
| PubChem CID | 135273031 |
| Molecular Formula | C24H14F12S2 |
| Molecular Weight | 594.49 g/mol |
| Exact Mass | 594.03 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3,6-bis[(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)sulfanyl]benzene |
| SMILES | CC(C)c1c(F)c(F)c(Sc2c(F)c(F)c(Sc3c(F)c(F)c(C(C)C)c(F)c3F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24H14F12S2/c1-5(2)7-9(25)13(29)21(14(30)10(7)26)37-23-17(33)19(35)24(20(36)18(23)34)38-22-15(31)11(27)8(6(3)4)12(28)16(22)32/h5-6H,1-4H3 |
| InChIKey | ZCSILASPQLZKRD-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.49 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|