(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid

C9H9F4O2P — CID 176944093

IUPAC(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid
SMILESCC(C)c1c(F)c(F)c(P(O)O)c(F)c1F
InChIInChI=1S/C9H9F4O2P/c1-3(2)4-5(10)7(12)9(16(14)15)8(13)6(4)11/h3,14-15H,1-2H3
InChIKeySPURUOJKNHHNDL-UHFFFAOYSA-N
MW256.13 g/mol
LogP2.29
Rot. Bonds2

About (2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid

(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid (PubChem CID 176944093) has the molecular formula C9H9F4O2P and a molecular weight of 256.13 g/mol. Its IUPAC name is (2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid.

Molecular Properties

Compound Name(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid
PubChem CID176944093
Molecular FormulaC9H9F4O2P
Molecular Weight256.13 g/mol
Exact Mass256.03
IUPAC Name(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid
SMILESCC(C)c1c(F)c(F)c(P(O)O)c(F)c1F
InChIInChI=1S/C9H9F4O2P/c1-3(2)4-5(10)7(12)9(16(14)15)8(13)6(4)11/h3,14-15H,1-2H3
InChIKeySPURUOJKNHHNDL-UHFFFAOYSA-N
XLogP2.29
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.13
LogP ≤ 52.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid?
The IUPAC name of (2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid (CID 176944093) is (2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid.
What is the SMILES notation for (2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid?
The canonical SMILES for (2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid is CC(C)c1c(F)c(F)c(P(O)O)c(F)c1F.
What is the InChIKey of (2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid?
The InChIKey is SPURUOJKNHHNDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F4O2P/c1-3(2)4-5(10)7(12)9(16(14)15)8(13)6(4)11/h3,14-15H,1-2H3.
What are the key properties of (2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid?
(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid has a molecular weight of 256.13 g/mol, XLogP of 2.29, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid is sourced from PubChem (CID 176944093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).