C9H9F4O2P — CID 176944093
(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid (PubChem CID 176944093) has the molecular formula C9H9F4O2P and a molecular weight of 256.13 g/mol. Its IUPAC name is (2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid.
| Compound Name | (2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid |
|---|---|
| PubChem CID | 176944093 |
| Molecular Formula | C9H9F4O2P |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | (2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phosphonous acid |
| SMILES | CC(C)c1c(F)c(F)c(P(O)O)c(F)c1F |
| InChI | InChI=1S/C9H9F4O2P/c1-3(2)4-5(10)7(12)9(16(14)15)8(13)6(4)11/h3,14-15H,1-2H3 |
| InChIKey | SPURUOJKNHHNDL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|