C17H12F8 — CID 174123096
1-ethyl-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)benzene (PubChem CID 174123096) has the molecular formula C17H12F8 and a molecular weight of 368.27 g/mol. Its IUPAC name is 1-ethyl-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)benzene.
| Compound Name | 1-ethyl-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)benzene |
|---|---|
| PubChem CID | 174123096 |
| Molecular Formula | C17H12F8 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 1-ethyl-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)benzene |
| SMILES | CCc1c(F)c(F)c(-c2c(F)c(F)c(C(C)C)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C17H12F8/c1-4-6-10(18)14(22)8(15(23)11(6)19)9-16(24)12(20)7(5(2)3)13(21)17(9)25/h5H,4H2,1-3H3 |
| InChIKey | BPTUCMFGLIHXAG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|