C34H26F12 — CID 155371318
1-[3,5-bis(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phenyl]-4-tert-butyl-2,3,5,6-tetrafluorobenzene (PubChem CID 155371318) has the molecular formula C34H26F12 and a molecular weight of 662.56 g/mol. Its IUPAC name is 1-[3,5-bis(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phenyl]-4-tert-butyl-2,3,5,6-tetrafluorobenzene.
| Compound Name | 1-[3,5-bis(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phenyl]-4-tert-butyl-2,3,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 155371318 |
| Molecular Formula | C34H26F12 |
| Molecular Weight | 662.56 g/mol |
| Exact Mass | 662.18 |
| IUPAC Name | 1-[3,5-bis(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phenyl]-4-tert-butyl-2,3,5,6-tetrafluorobenzene |
| SMILES | CC(C)c1c(F)c(F)c(-c2cc(-c3c(F)c(F)c(C(C)C)c(F)c3F)cc(-c3c(F)c(F)c(C(C)(C)C)c(F)c3F)c2)c(F)c1F |
| InChI | InChI=1S/C34H26F12/c1-11(2)16-22(35)26(39)18(27(40)23(16)36)13-8-14(19-28(41)24(37)17(12(3)4)25(38)29(19)42)10-15(9-13)20-30(43)32(45)21(34(5,6)7)33(46)31(20)44/h8-12H,1-7H3 |
| InChIKey | ZWOSKXVOUHTRON-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.56 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|