C21H21F7 — CID 158547115
1-tert-butyl-2-(2-tert-butyl-3,4,5,6-tetrafluorophenyl)-3,4,5-trifluoro-6-methylbenzene (PubChem CID 158547115) has the molecular formula C21H21F7 and a molecular weight of 406.39 g/mol. Its IUPAC name is 1-tert-butyl-2-(2-tert-butyl-3,4,5,6-tetrafluorophenyl)-3,4,5-trifluoro-6-methylbenzene.
| Compound Name | 1-tert-butyl-2-(2-tert-butyl-3,4,5,6-tetrafluorophenyl)-3,4,5-trifluoro-6-methylbenzene |
|---|---|
| PubChem CID | 158547115 |
| Molecular Formula | C21H21F7 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 1-tert-butyl-2-(2-tert-butyl-3,4,5,6-tetrafluorophenyl)-3,4,5-trifluoro-6-methylbenzene |
| SMILES | Cc1c(F)c(F)c(F)c(-c2c(F)c(F)c(F)c(F)c2C(C)(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C21H21F7/c1-8-11(20(2,3)4)9(14(23)17(26)13(8)22)10-12(21(5,6)7)16(25)19(28)18(27)15(10)24/h1-7H3 |
| InChIKey | SUYLJHJVVVVJPU-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|