C16H8AlF10- — CID 163928810
CID 163928810 (PubChem CID 163928810) has the molecular formula C16H8AlF10- and a molecular weight of 417.20 g/mol.
| Compound Name | CID 163928810 |
|---|---|
| PubChem CID | 163928810 |
| Molecular Formula | C16H8AlF10- |
| Molecular Weight | 417.20 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | — |
| SMILES | CCC(C)([Al-]F)c1c(F)c(F)c(F)c(F)c1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H8F9.Al.FH/c1-3-4(2)5-6(9(18)13(22)12(21)8(5)17)7-10(19)14(23)16(25)15(24)11(7)20;;/h3H2,1-2H3;;1H/p-1 |
| InChIKey | VAELJPOKLDNRRY-UHFFFAOYSA-M |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.20 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|