C15H17F7 — CID 89047086
1-(3,3-difluoro-2,4,4-trimethylhexan-2-yl)-2,3,4,5,6-pentafluorobenzene (PubChem CID 89047086) has the molecular formula C15H17F7 and a molecular weight of 330.29 g/mol. Its IUPAC name is 1-(3,3-difluoro-2,4,4-trimethylhexan-2-yl)-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-(3,3-difluoro-2,4,4-trimethylhexan-2-yl)-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 89047086 |
| Molecular Formula | C15H17F7 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-(3,3-difluoro-2,4,4-trimethylhexan-2-yl)-2,3,4,5,6-pentafluorobenzene |
| SMILES | CCC(C)(C)C(F)(F)C(C)(C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H17F7/c1-6-13(2,3)15(21,22)14(4,5)7-8(16)10(18)12(20)11(19)9(7)17/h6H2,1-5H3 |
| InChIKey | JUBOPWLDXLGZCP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|