C16H11F8P — CID 144766001
[2,3,6-trifluoro-5-methyl-4-[2-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]phenyl]phosphane (PubChem CID 144766001) has the molecular formula C16H11F8P and a molecular weight of 386.22 g/mol. Its IUPAC name is [2,3,6-trifluoro-5-methyl-4-[2-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]phenyl]phosphane.
| Compound Name | [2,3,6-trifluoro-5-methyl-4-[2-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]phenyl]phosphane |
|---|---|
| PubChem CID | 144766001 |
| Molecular Formula | C16H11F8P |
| Molecular Weight | 386.22 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | [2,3,6-trifluoro-5-methyl-4-[2-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]phenyl]phosphane |
| SMILES | Cc1c(F)c(P)c(F)c(F)c1C(C)(C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H11F8P/c1-4-5(8(18)14(24)15(25)7(4)17)16(2,3)6-9(19)11(21)13(23)12(22)10(6)20/h25H2,1-3H3 |
| InChIKey | JADSTCAXZKCTKD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.22 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|