C6H3F4OP — CID 130350697
2,3,4,6-tetrafluoro-5-phosphanylphenol (PubChem CID 130350697) has the molecular formula C6H3F4OP and a molecular weight of 198.05 g/mol. Its IUPAC name is 2,3,4,6-tetrafluoro-5-phosphanylphenol.
| Compound Name | 2,3,4,6-tetrafluoro-5-phosphanylphenol |
|---|---|
| PubChem CID | 130350697 |
| Molecular Formula | C6H3F4OP |
| Molecular Weight | 198.05 g/mol |
| Exact Mass | 197.99 |
| IUPAC Name | 2,3,4,6-tetrafluoro-5-phosphanylphenol |
| SMILES | Oc1c(F)c(F)c(F)c(P)c1F |
| InChI | InChI=1S/C6H3F4OP/c7-1-2(8)5(11)4(10)6(12)3(1)9/h11H,12H2 |
| InChIKey | DCIBGKPWUKEHJW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.05 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|