C18H2F12O4 — CID 15397011
2,3,4,6-tetrafluoro-5-[2,3,4,6-tetrafluoro-5-(2,3,4,6-tetrafluoro-5-hydroxyphenoxy)phenoxy]phenol (PubChem CID 15397011) has the molecular formula C18H2F12O4 and a molecular weight of 510.19 g/mol. Its IUPAC name is 2,3,4,6-tetrafluoro-5-[2,3,4,6-tetrafluoro-5-(2,3,4,6-tetrafluoro-5-hydroxyphenoxy)phenoxy]phenol.
| Compound Name | 2,3,4,6-tetrafluoro-5-[2,3,4,6-tetrafluoro-5-(2,3,4,6-tetrafluoro-5-hydroxyphenoxy)phenoxy]phenol |
|---|---|
| PubChem CID | 15397011 |
| Molecular Formula | C18H2F12O4 |
| Molecular Weight | 510.19 g/mol |
| Exact Mass | 509.98 |
| IUPAC Name | 2,3,4,6-tetrafluoro-5-[2,3,4,6-tetrafluoro-5-(2,3,4,6-tetrafluoro-5-hydroxyphenoxy)phenoxy]phenol |
| SMILES | Oc1c(F)c(F)c(F)c(Oc2c(F)c(F)c(F)c(Oc3c(F)c(O)c(F)c(F)c3F)c2F)c1F |
| InChI | InChI=1S/C18H2F12O4/c19-1-4(22)13(31)10(28)15(6(1)24)33-17-8(26)3(21)9(27)18(12(17)30)34-16-7(25)2(20)5(23)14(32)11(16)29/h31-32H |
| InChIKey | CSMIMANQDFDIID-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.19 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|