C12H6F4O2 — CID 173271189
3-(2,4-difluorophenoxy)-2,5-difluorophenol (PubChem CID 173271189) has the molecular formula C12H6F4O2 and a molecular weight of 258.17 g/mol. Its IUPAC name is 3-(2,4-difluorophenoxy)-2,5-difluorophenol.
| Compound Name | 3-(2,4-difluorophenoxy)-2,5-difluorophenol |
|---|---|
| PubChem CID | 173271189 |
| Molecular Formula | C12H6F4O2 |
| Molecular Weight | 258.17 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 3-(2,4-difluorophenoxy)-2,5-difluorophenol |
| SMILES | Oc1cc(F)cc(Oc2ccc(F)cc2F)c1F |
| InChI | InChI=1S/C12H6F4O2/c13-6-1-2-10(8(15)3-6)18-11-5-7(14)4-9(17)12(11)16/h1-5,17H |
| InChIKey | NDUDXZMXVQKYQO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.17 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |