C24F18O3 — CID 636241
1,2,3,4,5-pentafluoro-6-[2,4,6-trifluoro-3,5-bis(2,3,4,5,6-pentafluorophenoxy)phenoxy]benzene (PubChem CID 636241) has the molecular formula C24F18O3 and a molecular weight of 678.22 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[2,4,6-trifluoro-3,5-bis(2,3,4,5,6-pentafluorophenoxy)phenoxy]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[2,4,6-trifluoro-3,5-bis(2,3,4,5,6-pentafluorophenoxy)phenoxy]benzene |
|---|---|
| PubChem CID | 636241 |
| Molecular Formula | C24F18O3 |
| Molecular Weight | 678.22 g/mol |
| Exact Mass | 677.96 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[2,4,6-trifluoro-3,5-bis(2,3,4,5,6-pentafluorophenoxy)phenoxy]benzene |
| SMILES | Fc1c(F)c(F)c(Oc2c(F)c(Oc3c(F)c(F)c(F)c(F)c3F)c(F)c(Oc3c(F)c(F)c(F)c(F)c3F)c2F)c(F)c1F |
| InChI | InChI=1S/C24F18O3/c25-1-4(28)10(34)19(11(35)5(1)29)43-22-16(40)23(44-20-12(36)6(30)2(26)7(31)13(20)37)18(42)24(17(22)41)45-21-14(38)8(32)3(27)9(33)15(21)39 |
| InChIKey | WSOLSEJNTOXAJJ-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.22 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|