C28H42 — CID 158215736
1-tert-butyl-2-(2-tert-butyl-3,4,5,6-tetramethylphenyl)-3,4,5,6-tetramethylbenzene (PubChem CID 158215736) has the molecular formula C28H42 and a molecular weight of 378.64 g/mol. Its IUPAC name is 1-tert-butyl-2-(2-tert-butyl-3,4,5,6-tetramethylphenyl)-3,4,5,6-tetramethylbenzene.
| Compound Name | 1-tert-butyl-2-(2-tert-butyl-3,4,5,6-tetramethylphenyl)-3,4,5,6-tetramethylbenzene |
|---|---|
| PubChem CID | 158215736 |
| Molecular Formula | C28H42 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 378.33 |
| IUPAC Name | 1-tert-butyl-2-(2-tert-butyl-3,4,5,6-tetramethylphenyl)-3,4,5,6-tetramethylbenzene |
| SMILES | Cc1c(C)c(C)c(C(C)(C)C)c(-c2c(C)c(C)c(C)c(C)c2C(C)(C)C)c1C |
| InChI | InChI=1S/C28H42/c1-15-17(3)21(7)25(27(9,10)11)23(19(15)5)24-20(6)16(2)18(4)22(8)26(24)28(12,13)14/h1-14H3 |
| InChIKey | RBKKNOBVQRDNRQ-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |