C32H54Al2O2 — CID 134906131
dimethyl-[2-(2,3,4,5,6-pentamethylphenyl)propan-2-yloxy]alumane (PubChem CID 134906131) has the molecular formula C32H54Al2O2 and a molecular weight of 524.75 g/mol. Its IUPAC name is dimethyl-[2-(2,3,4,5,6-pentamethylphenyl)propan-2-yloxy]alumane.
| Compound Name | dimethyl-[2-(2,3,4,5,6-pentamethylphenyl)propan-2-yloxy]alumane |
|---|---|
| PubChem CID | 134906131 |
| Molecular Formula | C32H54Al2O2 |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.38 |
| IUPAC Name | dimethyl-[2-(2,3,4,5,6-pentamethylphenyl)propan-2-yloxy]alumane |
| SMILES | Cc1c(C)c(C)c(C(C)(C)O[Al](C)C)c(C)c1C.Cc1c(C)c(C)c(C(C)(C)O[Al](C)C)c(C)c1C |
| InChI | InChI=1S/2C14H21O.4CH3.2Al/c2*1-8-9(2)11(4)13(14(6,7)15)12(5)10(8)3;;;;;;/h2*1-7H3;4*1H3;;/q2*-1;;;;;2*+1 |
| InChIKey | INGLIOCYLAWTHM-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |