C16H26S2 — CID 121337528
2-[2,3,4,6-tetramethyl-5-(2-sulfanylpropan-2-yl)phenyl]propane-2-thiol (PubChem CID 121337528) has the molecular formula C16H26S2 and a molecular weight of 282.52 g/mol. Its IUPAC name is 2-[2,3,4,6-tetramethyl-5-(2-sulfanylpropan-2-yl)phenyl]propane-2-thiol.
| Compound Name | 2-[2,3,4,6-tetramethyl-5-(2-sulfanylpropan-2-yl)phenyl]propane-2-thiol |
|---|---|
| PubChem CID | 121337528 |
| Molecular Formula | C16H26S2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-[2,3,4,6-tetramethyl-5-(2-sulfanylpropan-2-yl)phenyl]propane-2-thiol |
| SMILES | Cc1c(C)c(C(C)(C)S)c(C)c(C(C)(C)S)c1C |
| InChI | InChI=1S/C16H26S2/c1-9-10(2)13(15(5,6)17)12(4)14(11(9)3)16(7,8)18/h17-18H,1-8H3 |
| InChIKey | IYJBZWBTVBAPSY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|