C23H30Cl2 — CID 135251989
1-chloro-4-[1-chloro-1-(2,3,4,5,6-pentamethylphenyl)ethyl]-2,3,5,6-tetramethylbenzene (PubChem CID 135251989) has the molecular formula C23H30Cl2 and a molecular weight of 377.40 g/mol. Its IUPAC name is 1-chloro-4-[1-chloro-1-(2,3,4,5,6-pentamethylphenyl)ethyl]-2,3,5,6-tetramethylbenzene.
| Compound Name | 1-chloro-4-[1-chloro-1-(2,3,4,5,6-pentamethylphenyl)ethyl]-2,3,5,6-tetramethylbenzene |
|---|---|
| PubChem CID | 135251989 |
| Molecular Formula | C23H30Cl2 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1-chloro-4-[1-chloro-1-(2,3,4,5,6-pentamethylphenyl)ethyl]-2,3,5,6-tetramethylbenzene |
| SMILES | Cc1c(C)c(C)c(C(C)(Cl)c2c(C)c(C)c(Cl)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C23H30Cl2/c1-11-12(2)14(4)20(15(5)13(11)3)23(10,25)21-16(6)18(8)22(24)19(9)17(21)7/h1-10H3 |
| InChIKey | HYWVXABPXVNSRF-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|