C16H9BF10 — CID 140727428
(4-tert-butyl-2,3,5,6-tetrafluorophenyl)-fluoro-(2,3,4,5,6-pentafluorophenyl)borane (PubChem CID 140727428) has the molecular formula C16H9BF10 and a molecular weight of 402.04 g/mol. Its IUPAC name is (4-tert-butyl-2,3,5,6-tetrafluorophenyl)-fluoro-(2,3,4,5,6-pentafluorophenyl)borane.
| Compound Name | (4-tert-butyl-2,3,5,6-tetrafluorophenyl)-fluoro-(2,3,4,5,6-pentafluorophenyl)borane |
|---|---|
| PubChem CID | 140727428 |
| Molecular Formula | C16H9BF10 |
| Molecular Weight | 402.04 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | (4-tert-butyl-2,3,5,6-tetrafluorophenyl)-fluoro-(2,3,4,5,6-pentafluorophenyl)borane |
| SMILES | CC(C)(C)c1c(F)c(F)c(B(F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C16H9BF10/c1-16(2,3)4-7(18)9(20)5(10(21)8(4)19)17(27)6-11(22)13(24)15(26)14(25)12(6)23/h1-3H3 |
| InChIKey | IEZNIILMXIAMBY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.04 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|