C21H3BF18 — CID 174104854
(2,3,5,6-tetrafluoro-4-methylphenyl)-bis[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]borane (PubChem CID 174104854) has the molecular formula C21H3BF18 and a molecular weight of 608.03 g/mol. Its IUPAC name is (2,3,5,6-tetrafluoro-4-methylphenyl)-bis[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]borane.
| Compound Name | (2,3,5,6-tetrafluoro-4-methylphenyl)-bis[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]borane |
|---|---|
| PubChem CID | 174104854 |
| Molecular Formula | C21H3BF18 |
| Molecular Weight | 608.03 g/mol |
| Exact Mass | 608.00 |
| IUPAC Name | (2,3,5,6-tetrafluoro-4-methylphenyl)-bis[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]borane |
| SMILES | Cc1c(F)c(F)c(B(c2c(F)c(F)c(C(F)(F)F)c(F)c2F)c2c(F)c(F)c(C(F)(F)F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C21H3BF18/c1-2-8(23)14(29)5(15(30)9(2)24)22(6-16(31)10(25)3(20(35,36)37)11(26)17(6)32)7-18(33)12(27)4(21(38,39)40)13(28)19(7)34/h1H3 |
| InChIKey | GYUPLHWKNSZMFW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.03 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|