C21H9BF12 — CID 159609966
bis(2,4,6-trifluoro-3-methylphenyl)-[2,4,6-trifluoro-3-(trifluoromethyl)phenyl]borane (PubChem CID 159609966) has the molecular formula C21H9BF12 and a molecular weight of 500.09 g/mol. Its IUPAC name is bis(2,4,6-trifluoro-3-methylphenyl)-[2,4,6-trifluoro-3-(trifluoromethyl)phenyl]borane.
| Compound Name | bis(2,4,6-trifluoro-3-methylphenyl)-[2,4,6-trifluoro-3-(trifluoromethyl)phenyl]borane |
|---|---|
| PubChem CID | 159609966 |
| Molecular Formula | C21H9BF12 |
| Molecular Weight | 500.09 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | bis(2,4,6-trifluoro-3-methylphenyl)-[2,4,6-trifluoro-3-(trifluoromethyl)phenyl]borane |
| SMILES | Cc1c(F)cc(F)c(B(c2c(F)cc(F)c(C)c2F)c2c(F)cc(F)c(C(F)(F)F)c2F)c1F |
| InChI | InChI=1S/C21H9BF12/c1-6-8(23)3-11(26)15(18(6)29)22(16-12(27)4-9(24)7(2)19(16)30)17-13(28)5-10(25)14(20(17)31)21(32,33)34/h3-5H,1-2H3 |
| InChIKey | HWLHILURCVKOLN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.09 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|