C8H8F2S — CID 175617271
3,5-difluoro-2,4-dimethylbenzenethiol (PubChem CID 175617271) has the molecular formula C8H8F2S and a molecular weight of 174.22 g/mol. Its IUPAC name is 3,5-difluoro-2,4-dimethylbenzenethiol.
| Compound Name | 3,5-difluoro-2,4-dimethylbenzenethiol |
|---|---|
| PubChem CID | 175617271 |
| Molecular Formula | C8H8F2S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | 3,5-difluoro-2,4-dimethylbenzenethiol |
| SMILES | Cc1c(F)cc(S)c(C)c1F |
| InChI | InChI=1S/C8H8F2S/c1-4-6(9)3-7(11)5(2)8(4)10/h3,11H,1-2H3 |
| InChIKey | YFORIUILAISNEI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|