C6H3F3S — CID 22351592
2,4,5-trifluorobenzenethiol (PubChem CID 22351592) has the molecular formula C6H3F3S and a molecular weight of 164.15 g/mol. Its IUPAC name is 2,4,5-trifluorobenzenethiol.
| Compound Name | 2,4,5-trifluorobenzenethiol |
|---|---|
| PubChem CID | 22351592 |
| Molecular Formula | C6H3F3S |
| Molecular Weight | 164.15 g/mol |
| Exact Mass | 163.99 |
| IUPAC Name | 2,4,5-trifluorobenzenethiol |
| SMILES | Fc1cc(F)c(S)cc1F |
| InChI | InChI=1S/C6H3F3S/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H |
| InChIKey | ODVDATKZUNPWNS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.15 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|