C8H6FNOS — CID 70639266
6-fluoro-2-methyl-1,3-benzoxazole-5-thiol (PubChem CID 70639266) has the molecular formula C8H6FNOS and a molecular weight of 183.21 g/mol. Its IUPAC name is 6-fluoro-2-methyl-1,3-benzoxazole-5-thiol.
| Compound Name | 6-fluoro-2-methyl-1,3-benzoxazole-5-thiol |
|---|---|
| PubChem CID | 70639266 |
| Molecular Formula | C8H6FNOS |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 6-fluoro-2-methyl-1,3-benzoxazole-5-thiol |
| SMILES | Cc1nc2cc(S)c(F)cc2o1 |
| InChI | InChI=1S/C8H6FNOS/c1-4-10-6-3-8(12)5(9)2-7(6)11-4/h2-3,12H,1H3 |
| InChIKey | ZRLFCOGOBLUJTE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|