C6H3F2NO2S — CID 90220196
2,4-difluoro-5-nitrobenzenethiol (PubChem CID 90220196) has the molecular formula C6H3F2NO2S and a molecular weight of 191.16 g/mol. Its IUPAC name is 2,4-difluoro-5-nitrobenzenethiol.
| Compound Name | 2,4-difluoro-5-nitrobenzenethiol |
|---|---|
| PubChem CID | 90220196 |
| Molecular Formula | C6H3F2NO2S |
| Molecular Weight | 191.16 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | 2,4-difluoro-5-nitrobenzenethiol |
| SMILES | O=[N+]([O-])c1cc(S)c(F)cc1F |
| InChI | InChI=1S/C6H3F2NO2S/c7-3-1-4(8)6(12)2-5(3)9(10)11/h1-2,12H |
| InChIKey | RJDMIXOPJOKXCU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 43.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.16 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|