C21H13BF8 — CID 177045505
(2,6-difluoro-3-methylphenyl)-bis(2,4,6-trifluoro-3-methylphenyl)borane (PubChem CID 177045505) has the molecular formula C21H13BF8 and a molecular weight of 428.13 g/mol. Its IUPAC name is (2,6-difluoro-3-methylphenyl)-bis(2,4,6-trifluoro-3-methylphenyl)borane.
| Compound Name | (2,6-difluoro-3-methylphenyl)-bis(2,4,6-trifluoro-3-methylphenyl)borane |
|---|---|
| PubChem CID | 177045505 |
| Molecular Formula | C21H13BF8 |
| Molecular Weight | 428.13 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | (2,6-difluoro-3-methylphenyl)-bis(2,4,6-trifluoro-3-methylphenyl)borane |
| SMILES | Cc1ccc(F)c(B(c2c(F)cc(F)c(C)c2F)c2c(F)cc(F)c(C)c2F)c1F |
| InChI | InChI=1S/C21H13BF8/c1-8-4-5-11(23)16(19(8)28)22(17-14(26)6-12(24)9(2)20(17)29)18-15(27)7-13(25)10(3)21(18)30/h4-7H,1-3H3 |
| InChIKey | AWQPKNBVOVFRIA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.13 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|