About (2,6-difluorophenyl)-bis(2,4,6-trifluorophenyl)borane
(2,6-difluorophenyl)-bis(2,4,6-trifluorophenyl)borane (PubChem CID 174149978) has the molecular formula C18H7BF8
and a molecular weight of 386.05 g/mol. Its IUPAC name is (2,6-difluorophenyl)-bis(2,4,6-trifluorophenyl)borane.
Molecular Properties
| Compound Name | (2,6-difluorophenyl)-bis(2,4,6-trifluorophenyl)borane |
| PubChem CID | 174149978 |
| Molecular Formula | C18H7BF8 |
| Molecular Weight | 386.05 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | (2,6-difluorophenyl)-bis(2,4,6-trifluorophenyl)borane |
| SMILES | Fc1cc(F)c(B(c2c(F)cccc2F)c2c(F)cc(F)cc2F)c(F)c1 |
| InChI | InChI=1S/C18H7BF8/c20-8-4-12(24)17(13(25)5-8)19(16-10(22)2-1-3-11(16)23)18-14(26)6-9(21)7-15(18)27/h1-7H |
| InChIKey | GDZYYHIFDFAIFN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.05 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2,6-difluorophenyl)-bis(2,4,6-trifluorophenyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-difluorophenyl)-bis(2,4,6-trifluorophenyl)borane?
The IUPAC name of (2,6-difluorophenyl)-bis(2,4,6-trifluorophenyl)borane (CID 174149978) is (2,6-difluorophenyl)-bis(2,4,6-trifluorophenyl)borane.
What is the SMILES notation for (2,6-difluorophenyl)-bis(2,4,6-trifluorophenyl)borane?
The canonical SMILES for (2,6-difluorophenyl)-bis(2,4,6-trifluorophenyl)borane is Fc1cc(F)c(B(c2c(F)cccc2F)c2c(F)cc(F)cc2F)c(F)c1.
What is the InChIKey of (2,6-difluorophenyl)-bis(2,4,6-trifluorophenyl)borane?
The InChIKey is GDZYYHIFDFAIFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H7BF8/c20-8-4-12(24)17(13(25)5-8)19(16-10(22)2-1-3-11(16)23)18-14(26)6-9(21)7-15(18)27/h1-7H.
What are the key properties of (2,6-difluorophenyl)-bis(2,4,6-trifluorophenyl)borane?
(2,6-difluorophenyl)-bis(2,4,6-trifluorophenyl)borane has a molecular weight of 386.05 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-difluorophenyl)-bis(2,4,6-trifluorophenyl)borane is sourced from PubChem (CID 174149978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).